C25H34N2O — CID 9894291
1-(cis-1-(3-Ethoxyphenyl)-4-methylcyclohexyl)-4-phenylpiperazine (PubChem CID 9894291) has the molecular formula C25H34N2O and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[1-(3-ethoxyphenyl)-4-methylcyclohexyl]-4-phenylpiperazine.
| Compound Name | 1-(cis-1-(3-Ethoxyphenyl)-4-methylcyclohexyl)-4-phenylpiperazine |
|---|---|
| PubChem CID | 9894291 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-[1-(3-ethoxyphenyl)-4-methylcyclohexyl]-4-phenylpiperazine |
| SMILES | CCOC1=CC=CC(=C1)C2(CCC(CC2)C)N3CCN(CC3)C4=CC=CC=C4 |
| InChI | InChI=1S/C25H34N2O/c1-3-28-24-11-7-8-22(20-24)25(14-12-21(2)13-15-25)27-18-16-26(17-19-27)23-9-5-4-6-10-23/h4-11,20-21H,3,12-19H2,1-2H3 |
| InChIKey | HKVWLCPNTJYNBO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 15.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 459 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |