C22H22N4O3 — CID 989638
7-benzyl-8-(2,5-dimethylphenoxy)-1,3-dimethylpurine-2,6-dione (PubChem CID 989638) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 7-benzyl-8-(2,5-dimethylphenoxy)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(2,5-dimethylphenoxy)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 989638 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 7-benzyl-8-(2,5-dimethylphenoxy)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1ccc(C)c(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-14-10-11-15(2)17(12-14)29-21-23-19-18(20(27)25(4)22(28)24(19)3)26(21)13-16-8-6-5-7-9-16/h5-12H,13H2,1-4H3 |
| InChIKey | YPOMCIZTNXZMOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |