About 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one
2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 989994) has the molecular formula C22H17ClO4
and a molecular weight of 380.83 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one |
| PubChem CID | 989994 |
| Molecular Formula | C22H17ClO4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | CCc1c(C(=O)c2ccc(Cl)cc2)oc2c(C)c3oc(=O)cc(C)c3cc12 |
| InChI | InChI=1S/C22H17ClO4/c1-4-15-17-10-16-11(2)9-18(24)26-20(16)12(3)21(17)27-22(15)19(25)13-5-7-14(23)8-6-13/h5-10H,4H2,1-3H3 |
| InChIKey | HYBNDUXUKUOOOR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one?
The IUPAC name of 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one (CID 989994) is 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one?
The canonical SMILES for 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one is CCc1c(C(=O)c2ccc(Cl)cc2)oc2c(C)c3oc(=O)cc(C)c3cc12.
What is the InChIKey of 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one?
The InChIKey is HYBNDUXUKUOOOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClO4/c1-4-15-17-10-16-11(2)9-18(24)26-20(16)12(3)21(17)27-22(15)19(25)13-5-7-14(23)8-6-13/h5-10H,4H2,1-3H3.
What are the key properties of 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one?
2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one has a molecular weight of 380.83 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorobenzoyl)-3-ethyl-5,9-dimethylfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 989994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).