C24H19N5OS — CID 990301
3-(3-amino-4,6-diphenylfuro[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione (PubChem CID 990301) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 3-(3-amino-4,6-diphenylfuro[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-amino-4,6-diphenylfuro[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 990301 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-(3-amino-4,6-diphenylfuro[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
| SMILES | C=CCn1c(-c2oc3nc(-c4ccccc4)cc(-c4ccccc4)c3c2N)n[nH]c1=S |
| InChI | InChI=1S/C24H19N5OS/c1-2-13-29-22(27-28-24(29)31)21-20(25)19-17(15-9-5-3-6-10-15)14-18(26-23(19)30-21)16-11-7-4-8-12-16/h2-12,14H,1,13,25H2,(H,28,31) |
| InChIKey | AERHSHISZHOWJM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|