About Prolyl-glycyl-proline
Prolyl-glycyl-proline (PubChem CID 9903507) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-1-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]acetyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | Prolyl-glycyl-proline |
| PubChem CID | 9903507 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-1-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | C1C[C@H](NC1)C(=O)NCC(=O)N2CCC[C@H]2C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c16-10(15-6-2-4-9(15)12(18)19)7-14-11(17)8-3-1-5-13-8/h8-9,13H,1-7H2,(H,14,17)(H,18,19)/t8-,9-/m0/s1 |
| InChIKey | BRPMXFSTKXXNHF-IUCAKERBSA-N |
| XLogP | -3.00 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 385 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Prolyl-glycyl-proline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prolyl-glycyl-proline?
The IUPAC name of Prolyl-glycyl-proline (CID 9903507) is (2S)-1-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]acetyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for Prolyl-glycyl-proline?
The canonical SMILES for Prolyl-glycyl-proline is C1C[C@H](NC1)C(=O)NCC(=O)N2CCC[C@H]2C(=O)O.
What is the InChIKey of Prolyl-glycyl-proline?
The InChIKey is BRPMXFSTKXXNHF-IUCAKERBSA-N. The full InChI is InChI=1S/C12H19N3O4/c16-10(15-6-2-4-9(15)12(18)19)7-14-11(17)8-3-1-5-13-8/h8-9,13H,1-7H2,(H,14,17)(H,18,19)/t8-,9-/m0/s1.
What are the key properties of Prolyl-glycyl-proline?
Prolyl-glycyl-proline has a molecular weight of 269.30 g/mol, XLogP of -3.00, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Prolyl-glycyl-proline is sourced from PubChem (CID 9903507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).