About 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one
2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one (PubChem CID 990460) has the molecular formula C22H29N5O2
and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one |
| PubChem CID | 990460 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one |
| SMILES | CCOc1ccc(-n2nc3c(=O)n(CCN4CCCCC4)nc(C)c3c2C)cc1 |
| InChI | InChI=1S/C22H29N5O2/c1-4-29-19-10-8-18(9-11-19)27-17(3)20-16(2)23-26(22(28)21(20)24-27)15-14-25-12-6-5-7-13-25/h8-11H,4-7,12-15H2,1-3H3 |
| InChIKey | VNFULSHVENLOSX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one?
The IUPAC name of 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one (CID 990460) is 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one.
What is the SMILES notation for 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one?
The canonical SMILES for 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one is CCOc1ccc(-n2nc3c(=O)n(CCN4CCCCC4)nc(C)c3c2C)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one?
The InChIKey is VNFULSHVENLOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N5O2/c1-4-29-19-10-8-18(9-11-19)27-17(3)20-16(2)23-26(22(28)21(20)24-27)15-14-25-12-6-5-7-13-25/h8-11H,4-7,12-15H2,1-3H3.
What are the key properties of 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one?
2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one has a molecular weight of 395.51 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-3,4-dimethyl-6-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyridazin-7-one is sourced from PubChem (CID 990460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).