C19H14ClN3S2 — CID 990657
16-(4-chlorophenyl)-4-methyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),4,9,11(15)-pentaene-6-thione (PubChem CID 990657) has the molecular formula C19H14ClN3S2 and a molecular weight of 383.93 g/mol. Its IUPAC name is 16-(4-chlorophenyl)-4-methyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),4,9,11(15)-pentaene-6-thione.
| Compound Name | 16-(4-chlorophenyl)-4-methyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),4,9,11(15)-pentaene-6-thione |
|---|---|
| PubChem CID | 990657 |
| Molecular Formula | C19H14ClN3S2 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 16-(4-chlorophenyl)-4-methyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),4,9,11(15)-pentaene-6-thione |
| SMILES | Cc1nc(=S)c2sc3nc4c(c(-c5ccc(Cl)cc5)c3c2[nH]1)CCC4 |
| InChI | InChI=1S/C19H14ClN3S2/c1-9-21-16-15-14(10-5-7-11(20)8-6-10)12-3-2-4-13(12)23-19(15)25-17(16)18(24)22-9/h5-8H,2-4H2,1H3,(H,21,22,24) |
| InChIKey | OKMZWAJRWDGGKX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|