C18H9ClN4S2 — CID 990727
6-chloro-13-phenyl-11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 990727) has the molecular formula C18H9ClN4S2 and a molecular weight of 380.89 g/mol. Its IUPAC name is 6-chloro-13-phenyl-11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-chloro-13-phenyl-11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 990727 |
| Molecular Formula | C18H9ClN4S2 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 6-chloro-13-phenyl-11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Clc1nnnc2c1sc1nc(-c3cccs3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H9ClN4S2/c19-17-16-15(21-23-22-17)14-11(10-5-2-1-3-6-10)9-12(20-18(14)25-16)13-7-4-8-24-13/h1-9H |
| InChIKey | YVDTWUXHEGEXIS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |