C16H16N2O4 — CID 99090564
N-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 99090564) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 99090564 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)NN1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C16H16N2O4/c19-11-7-5-10(6-8-11)9-14(20)17-18-15(21)12-3-1-2-4-13(12)16(18)22/h1-2,5-8,12-13,19H,3-4,9H2,(H,17,20)/t12-,13-/m1/s1 |
| InChIKey | OVNQGHOEKPMISG-CHWSQXEVSA-N |
| XLogP | 0.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|