C32H27ClF2N4O3 — CID 99098374
(5S)-3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 99098374) has the molecular formula C32H27ClF2N4O3 and a molecular weight of 589.04 g/mol. Its IUPAC name is (5S)-3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99098374 |
| Molecular Formula | C32H27ClF2N4O3 |
| Molecular Weight | 589.04 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | (5S)-3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)N2N=C3/C(=C/c4ccc(F)cc4)CCC[C@@H]3[C@@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C32H27ClF2N4O3/c1-32(22-9-11-23(33)12-10-22)30(41)38(31(42)36-32)18-27(40)39-29(20-7-15-25(35)16-8-20)26-4-2-3-21(28(26)37-39)17-19-5-13-24(34)14-6-19/h5-17,26,29H,2-4,18H2,1H3,(H,36,42)/b21-17+/t26-,29-,32-/m0/s1 |
| InChIKey | QQCXFBZJNRBWHW-QRTVZNSWSA-N |
| XLogP | 6.21 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.04 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|