C17H21N3OS — CID 99103439
[(5S,7S)-5,7-dimethyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-[(1S,2R)-2-(5-methylthiophen-2-yl)cyclopropyl]methanone (PubChem CID 99103439) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is [(5S,7S)-5,7-dimethyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-[(1S,2R)-2-(5-methylthiophen-2-yl)cyclopropyl]methanone.
| Compound Name | [(5S,7S)-5,7-dimethyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-[(1S,2R)-2-(5-methylthiophen-2-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 99103439 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [(5S,7S)-5,7-dimethyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-[(1S,2R)-2-(5-methylthiophen-2-yl)cyclopropyl]methanone |
| SMILES | Cc1ccc([C@@H]2C[C@@H]2C(=O)N2c3ccnn3[C@@H](C)C[C@@H]2C)s1 |
| InChI | InChI=1S/C17H21N3OS/c1-10-8-11(2)20-16(6-7-18-20)19(10)17(21)14-9-13(14)15-5-4-12(3)22-15/h4-7,10-11,13-14H,8-9H2,1-3H3/t10-,11-,13+,14-/m0/s1 |
| InChIKey | FLFGIWXPCNBYRE-VTPLQMEGSA-N |
| XLogP | 3.74 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |