C18H22FNO2 — CID 99105348
(Z)-N-[(1S,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3-fluorophenyl)-N-methylprop-2-enamide (PubChem CID 99105348) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is (Z)-N-[(1S,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3-fluorophenyl)-N-methylprop-2-enamide.
| Compound Name | (Z)-N-[(1S,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3-fluorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 99105348 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (Z)-N-[(1S,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3-fluorophenyl)-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C\c1cccc(F)c1)[C@@H]1[C@@H]2CCO[C@@H]2C1(C)C |
| InChI | InChI=1S/C18H22FNO2/c1-18(2)16(14-9-10-22-17(14)18)20(3)15(21)8-7-12-5-4-6-13(19)11-12/h4-8,11,14,16-17H,9-10H2,1-3H3/b8-7-/t14-,16+,17-/m0/s1 |
| InChIKey | OLMKBFCEYDUCLB-ZCOVRYRNSA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|