About 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid
6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid (PubChem CID 99109910) has the molecular formula C10H6F5NO2S
and a molecular weight of 299.22 g/mol. Its IUPAC name is 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid |
| PubChem CID | 99109910 |
| Molecular Formula | C10H6F5NO2S |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccc(S(F)(F)(F)(F)F)cc2c1 |
| InChI | InChI=1S/C10H6F5NO2S/c11-19(12,13,14,15)8-1-2-9-6(4-8)3-7(5-16-9)10(17)18/h1-5H,(H,17,18) |
| InChIKey | KLSJNWBJQWCYDO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid?
The IUPAC name of 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid (CID 99109910) is 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid.
What is the SMILES notation for 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid?
The canonical SMILES for 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid is O=C(O)c1cnc2ccc(S(F)(F)(F)(F)F)cc2c1.
What is the InChIKey of 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid?
The InChIKey is KLSJNWBJQWCYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F5NO2S/c11-19(12,13,14,15)8-1-2-9-6(4-8)3-7(5-16-9)10(17)18/h1-5H,(H,17,18).
What are the key properties of 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid?
6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid has a molecular weight of 299.22 g/mol, XLogP of 4.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pentafluoro-λ6-sulfanyl)quinoline-3-carboxylic acid is sourced from PubChem (CID 99109910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).