C18H16N2O4 — CID 99110943
(1S,9R)-9-methyl-11-oxo-10-phenyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 99110943) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (1S,9R)-9-methyl-11-oxo-10-phenyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | (1S,9R)-9-methyl-11-oxo-10-phenyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 99110943 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (1S,9R)-9-methyl-11-oxo-10-phenyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | C[C@@]12C[C@H](NC(=O)N1c1ccccc1)c1cc(C(=O)O)ccc1O2 |
| InChI | InChI=1S/C18H16N2O4/c1-18-10-14(13-9-11(16(21)22)7-8-15(13)24-18)19-17(23)20(18)12-5-3-2-4-6-12/h2-9,14H,10H2,1H3,(H,19,23)(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | OLABMJSJFJZDLF-KBXCAEBGSA-N |
| XLogP | 3.15 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |