C21H19F4N3O2S2 — CID 99128962
[(2R)-1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 99128962) has the molecular formula C21H19F4N3O2S2 and a molecular weight of 485.53 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [(2R)-1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 99128962 |
| Molecular Formula | C21H19F4N3O2S2 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H19F4N3O2S2/c1-10(20(30)26-19-17(24)13(22)6-14(23)18(19)25)32-21(31)27-7-11-5-12(9-27)15-3-2-4-16(29)28(15)8-11/h2-4,6,10-12H,5,7-9H2,1H3,(H,26,30)/t10-,11+,12+/m1/s1 |
| InChIKey | NAYFUMDMDRRTOG-WOPDTQHZSA-N |
| XLogP | 3.87 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|