C17H21N3O4 — CID 99129778
(3S)-1-(4-methoxyphenyl)-3-[[(2R)-7-oxoazepan-2-yl]amino]pyrrolidine-2,5-dione (PubChem CID 99129778) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-3-[[(2R)-7-oxoazepan-2-yl]amino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-methoxyphenyl)-3-[[(2R)-7-oxoazepan-2-yl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99129778 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-3-[[(2R)-7-oxoazepan-2-yl]amino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](N[C@H]3CCCCC(=O)N3)C2=O)cc1 |
| InChI | InChI=1S/C17H21N3O4/c1-24-12-8-6-11(7-9-12)20-16(22)10-13(17(20)23)18-14-4-2-3-5-15(21)19-14/h6-9,13-14,18H,2-5,10H2,1H3,(H,19,21)/t13-,14+/m0/s1 |
| InChIKey | VECQTKGCLGWAIX-UONOGXRCSA-N |
| XLogP | 0.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|