C23H31N3O2 — CID 99131284
(2R)-2-(3,4-dimethylphenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]butanamide (PubChem CID 99131284) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]butanamide.
| Compound Name | (2R)-2-(3,4-dimethylphenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 99131284 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2R)-2-(3,4-dimethylphenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1ccc(C)c(C)c1)C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-5-22(28-21-11-6-17(2)18(3)16-21)23(27)24-19-7-9-20(10-8-19)26-14-12-25(4)13-15-26/h6-11,16,22H,5,12-15H2,1-4H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | NTCUPOQSPGPBII-JOCHJYFZSA-N |
| XLogP | 3.85 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|