C22H19F2NOS — CID 99136888
2-[bis(4-fluorophenyl)methylsulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 99136888) has the molecular formula C22H19F2NOS and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 99136888 |
| Molecular Formula | C22H19F2NOS |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CSC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19F2NOS/c1-15-4-2-3-5-20(15)25-21(26)14-27-22(16-6-10-18(23)11-7-16)17-8-12-19(24)13-9-17/h2-13,22H,14H2,1H3,(H,25,26) |
| InChIKey | BFYOVISINUHZHJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |