C24H30N4O2S — CID 99136913
1-[[5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]piperidine (PubChem CID 99136913) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-[[5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]piperidine.
| Compound Name | 1-[[5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 99136913 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[[5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]piperidine |
| SMILES | CCOc1ccc(OCCSc2nnc(CN3CCCCC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H30N4O2S/c1-2-29-21-11-13-22(14-12-21)30-17-18-31-24-26-25-23(19-27-15-7-4-8-16-27)28(24)20-9-5-3-6-10-20/h3,5-6,9-14H,2,4,7-8,15-19H2,1H3 |
| InChIKey | CEWSMSQUOFQYBV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|