About 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one
3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one (PubChem CID 991506) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one |
| PubChem CID | 991506 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one |
| SMILES | COc1ccc(-n2c(CN3CCOCC3)nc3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-26-15-7-8-18(19(13-15)27-2)24-20(14-23-9-11-28-12-10-23)22-17-6-4-3-5-16(17)21(24)25/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | QQUUWCGEIXEAFH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one (CID 991506) is 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one is COc1ccc(-n2c(CN3CCOCC3)nc3ccccc3c2=O)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one?
The InChIKey is QQUUWCGEIXEAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-26-15-7-8-18(19(13-15)27-2)24-20(14-23-9-11-28-12-10-23)22-17-6-4-3-5-16(17)21(24)25/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one?
3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one has a molecular weight of 381.43 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-2-(morpholin-4-ylmethyl)quinazolin-4-one is sourced from PubChem (CID 991506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).