C22H22N6OS — CID 99154660
N-[[4-(dimethylamino)phenyl]methyl]-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 99154660) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 99154660 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | CN(C)c1ccc(CNC(=O)CSc2ncnc3c2cnn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N6OS/c1-27(2)17-10-8-16(9-11-17)12-23-20(29)14-30-22-19-13-26-28(21(19)24-15-25-22)18-6-4-3-5-7-18/h3-11,13,15H,12,14H2,1-2H3,(H,23,29) |
| InChIKey | CQTHPGGVRMRBKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|