About 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one
6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one (PubChem CID 991689) has the molecular formula C12H7Br2N3OS
and a molecular weight of 401.08 g/mol. Its IUPAC name is 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one.
Molecular Properties
| Compound Name | 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one |
| PubChem CID | 991689 |
| Molecular Formula | C12H7Br2N3OS |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.87 |
| IUPAC Name | 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one |
| SMILES | Cc1nc2c(Br)cc(Br)cc2c(=O)n1-c1nccs1 |
| InChI | InChI=1S/C12H7Br2N3OS/c1-6-16-10-8(4-7(13)5-9(10)14)11(18)17(6)12-15-2-3-19-12/h2-5H,1H3 |
| InChIKey | PPMMVLRTCNNZJA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one?
The IUPAC name of 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one (CID 991689) is 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one.
What is the SMILES notation for 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one?
The canonical SMILES for 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one is Cc1nc2c(Br)cc(Br)cc2c(=O)n1-c1nccs1.
What is the InChIKey of 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one?
The InChIKey is PPMMVLRTCNNZJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Br2N3OS/c1-6-16-10-8(4-7(13)5-9(10)14)11(18)17(6)12-15-2-3-19-12/h2-5H,1H3.
What are the key properties of 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one?
6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one has a molecular weight of 401.08 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-methyl-3-(1,3-thiazol-2-yl)quinazolin-4-one is sourced from PubChem (CID 991689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).