About 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione
5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione (PubChem CID 991836) has the molecular formula C28H27N3O3
and a molecular weight of 453.54 g/mol. Its IUPAC name is 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione |
| PubChem CID | 991836 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)N4CCN(c5ccc(C)c(C)c5)CC4)cc3C2=O)cc1 |
| InChI | InChI=1S/C28H27N3O3/c1-18-4-8-22(9-5-18)31-27(33)24-11-7-21(17-25(24)28(31)34)26(32)30-14-12-29(13-15-30)23-10-6-19(2)20(3)16-23/h4-11,16-17H,12-15H2,1-3H3 |
| InChIKey | AOEPYTWJGKZASP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione?
The IUPAC name of 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione (CID 991836) is 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione.
What is the SMILES notation for 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione?
The canonical SMILES for 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione is Cc1ccc(N2C(=O)c3ccc(C(=O)N4CCN(c5ccc(C)c(C)c5)CC4)cc3C2=O)cc1.
What is the InChIKey of 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione?
The InChIKey is AOEPYTWJGKZASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O3/c1-18-4-8-22(9-5-18)31-27(33)24-11-7-21(17-25(24)28(31)34)26(32)30-14-12-29(13-15-30)23-10-6-19(2)20(3)16-23/h4-11,16-17H,12-15H2,1-3H3.
What are the key properties of 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione?
5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione has a molecular weight of 453.54 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]-2-(4-methylphenyl)isoindole-1,3-dione is sourced from PubChem (CID 991836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).