About Glyceryl 1-undecylenate
Glyceryl 1-undecylenate (PubChem CID 9921382) has the molecular formula C14H26O4
and a molecular weight of 258.35 g/mol. Its IUPAC name is 2,3-dihydroxypropyl undec-10-enoate.
Molecular Properties
| Compound Name | Glyceryl 1-undecylenate |
| PubChem CID | 9921382 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,3-dihydroxypropyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCC(CO)O |
| InChI | InChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-10-14(17)18-12-13(16)11-15/h2,13,15-16H,1,3-12H2 |
| InChIKey | GJVUMEONPPTZEY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | 216 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Glyceryl 1-undecylenate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Glyceryl 1-undecylenate?
The IUPAC name of Glyceryl 1-undecylenate (CID 9921382) is 2,3-dihydroxypropyl undec-10-enoate.
What is the SMILES notation for Glyceryl 1-undecylenate?
The canonical SMILES for Glyceryl 1-undecylenate is C=CCCCCCCCCC(=O)OCC(CO)O.
What is the InChIKey of Glyceryl 1-undecylenate?
The InChIKey is GJVUMEONPPTZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-10-14(17)18-12-13(16)11-15/h2,13,15-16H,1,3-12H2.
What are the key properties of Glyceryl 1-undecylenate?
Glyceryl 1-undecylenate has a molecular weight of 258.35 g/mol, XLogP of 3.10, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Glyceryl 1-undecylenate is sourced from PubChem (CID 9921382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).