About 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid
3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 992296) has the molecular formula C18H15N3O6S
and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid |
| PubChem CID | 992296 |
| Molecular Formula | C18H15N3O6S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1cc(NC(=O)c2cccc(S(=O)(=O)Nc3cccc(C(=O)O)c3)c2)no1 |
| InChI | InChI=1S/C18H15N3O6S/c1-11-8-16(20-27-11)19-17(22)12-4-3-7-15(10-12)28(25,26)21-14-6-2-5-13(9-14)18(23)24/h2-10,21H,1H3,(H,23,24)(H,19,20,22) |
| InChIKey | AMAKDQNDNCQEJM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid?
The IUPAC name of 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid (CID 992296) is 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid.
What is the SMILES notation for 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid?
The canonical SMILES for 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid is Cc1cc(NC(=O)c2cccc(S(=O)(=O)Nc3cccc(C(=O)O)c3)c2)no1.
What is the InChIKey of 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid?
The InChIKey is AMAKDQNDNCQEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O6S/c1-11-8-16(20-27-11)19-17(22)12-4-3-7-15(10-12)28(25,26)21-14-6-2-5-13(9-14)18(23)24/h2-10,21H,1H3,(H,23,24)(H,19,20,22).
What are the key properties of 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid?
3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid has a molecular weight of 401.40 g/mol, XLogP of 2.73, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid is sourced from PubChem (CID 992296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).