C7H3F5O — CID 9923
(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 9923) has the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 9923 |
| Molecular Formula | C7H3F5O |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H3F5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2 |
| InChIKey | PGJYYCIOYBZTPU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|