About 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide
2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide (PubChem CID 99234418) has the molecular formula C15H21NO4S
and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide.
Molecular Properties
| Compound Name | 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide |
| PubChem CID | 99234418 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide |
| SMILES | CC(C)CS(=O)(=O)NC(=O)C[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C15H21NO4S/c1-11(2)10-21(18,19)16-15(17)9-14-13-6-4-3-5-12(13)7-8-20-14/h3-6,11,14H,7-10H2,1-2H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | MTTQFPCQEKQEDW-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide?
The IUPAC name of 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide (CID 99234418) is 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide.
What is the SMILES notation for 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide?
The canonical SMILES for 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide is CC(C)CS(=O)(=O)NC(=O)C[C@@H]1OCCc2ccccc21.
What is the InChIKey of 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide?
The InChIKey is MTTQFPCQEKQEDW-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H21NO4S/c1-11(2)10-21(18,19)16-15(17)9-14-13-6-4-3-5-12(13)7-8-20-14/h3-6,11,14H,7-10H2,1-2H3,(H,16,17)/t14-/m0/s1.
What are the key properties of 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide?
2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide has a molecular weight of 311.40 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]-N-(2-methylpropylsulfonyl)acetamide is sourced from PubChem (CID 99234418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).