C25H26N2O5S2 — CID 992575
1,3-bis[(2,4,5-trimethylphenyl)sulfonyl]benzimidazol-2-one (PubChem CID 992575) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1,3-bis[(2,4,5-trimethylphenyl)sulfonyl]benzimidazol-2-one.
| Compound Name | 1,3-bis[(2,4,5-trimethylphenyl)sulfonyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 992575 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1,3-bis[(2,4,5-trimethylphenyl)sulfonyl]benzimidazol-2-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2c(=O)n(S(=O)(=O)c3cc(C)c(C)cc3C)c3ccccc32)cc1C |
| InChI | InChI=1S/C25H26N2O5S2/c1-15-11-19(5)23(13-17(15)3)33(29,30)26-21-9-7-8-10-22(21)27(25(26)28)34(31,32)24-14-18(4)16(2)12-20(24)6/h7-14H,1-6H3 |
| InChIKey | CSWVXFIGVXUXTA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |