About ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate
ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate (PubChem CID 992663) has the molecular formula C18H22N2O4S
and a molecular weight of 362.45 g/mol. Its IUPAC name is ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate |
| PubChem CID | 992663 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-4-24-18(21)19-12-15-8-10-16(11-9-15)25(22,23)20-17-13(2)6-5-7-14(17)3/h5-11,20H,4,12H2,1-3H3,(H,19,21) |
| InChIKey | ZFBJKXCESYEVPH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate?
The IUPAC name of ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate (CID 992663) is ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate.
What is the SMILES notation for ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate?
The canonical SMILES for ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate is CCOC(=O)NCc1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1.
What is the InChIKey of ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate?
The InChIKey is ZFBJKXCESYEVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4S/c1-4-24-18(21)19-12-15-8-10-16(11-9-15)25(22,23)20-17-13(2)6-5-7-14(17)3/h5-11,20H,4,12H2,1-3H3,(H,19,21).
What are the key properties of ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate?
ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate has a molecular weight of 362.45 g/mol, XLogP of 3.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]methyl]carbamate is sourced from PubChem (CID 992663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).