About [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone
[4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 992692) has the molecular formula C18H16FN3O2S
and a molecular weight of 357.41 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| PubChem CID | 992692 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C18H16FN3O2S/c19-14-5-3-13(4-6-14)15-12-25-18(20-15)22-9-7-21(8-10-22)17(23)16-2-1-11-24-16/h1-6,11-12H,7-10H2 |
| InChIKey | IPTGPGWNNBAVMW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone?
The IUPAC name of [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone (CID 992692) is [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone?
The canonical SMILES for [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone is O=C(c1ccco1)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1.
What is the InChIKey of [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone?
The InChIKey is IPTGPGWNNBAVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O2S/c19-14-5-3-13(4-6-14)15-12-25-18(20-15)22-9-7-21(8-10-22)17(23)16-2-1-11-24-16/h1-6,11-12H,7-10H2.
What are the key properties of [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone?
[4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone has a molecular weight of 357.41 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 992692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).