C26H21FN4O2S2 — CID 992874
2-[3-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 992874) has the molecular formula C26H21FN4O2S2 and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-[3-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[3-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 992874 |
| Molecular Formula | C26H21FN4O2S2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 2-[3-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=S)N(c3ccccc3F)C2=O)c(C)n1-c1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C26H21FN4O2S2/c1-14-11-16(15(2)30(14)25-19(13-28)17-7-3-6-10-22(17)35-25)12-18-23(32)29-26(34)31(24(18)33)21-9-5-4-8-20(21)27/h4-5,8-9,11-12H,3,6-7,10H2,1-2H3,(H,29,32,34)/b18-12+ |
| InChIKey | GACPBRFYLUPENN-LDADJPATSA-N |
| XLogP | 4.88 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|