C20H22N4O2S — CID 993079
N-(2,4-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]acetamide (PubChem CID 993079) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]acetamide |
|---|---|
| PubChem CID | 993079 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nnc3sc4c(c3c2=O)CC[C@H](C)C4)c(C)c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-11-5-7-15(13(3)8-11)21-17(25)10-24-20(26)18-14-6-4-12(2)9-16(14)27-19(18)22-23-24/h5,7-8,12H,4,6,9-10H2,1-3H3,(H,21,25)/t12-/m0/s1 |
| InChIKey | XDGFRNSJNCVVFX-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |