C18H19N5O3 — CID 99336157
N-[2-[(3-methoxyphenyl)carbamoylamino]ethyl]-1H-indazole-3-carboxamide (PubChem CID 99336157) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[2-[(3-methoxyphenyl)carbamoylamino]ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-[(3-methoxyphenyl)carbamoylamino]ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 99336157 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[2-[(3-methoxyphenyl)carbamoylamino]ethyl]-1H-indazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)NCCNC(=O)c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C18H19N5O3/c1-26-13-6-4-5-12(11-13)21-18(25)20-10-9-19-17(24)16-14-7-2-3-8-15(14)22-23-16/h2-8,11H,9-10H2,1H3,(H,19,24)(H,22,23)(H2,20,21,25) |
| InChIKey | SDJHIZJRXPVTCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|