C28H37N5O — CID 9933918
N-[(2S)-1-phenyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]adamantane-1-carboxamide (PubChem CID 9933918) has the molecular formula C28H37N5O and a molecular weight of 459.60 g/mol. Its IUPAC name is N-[(2S)-1-phenyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[(2S)-1-phenyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9933918 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | N-[(2S)-1-phenyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]adamantane-1-carboxamide |
| SMILES | C1CN(CCN1C[C@H](CC2=CC=CC=C2)NC(=O)C34CC5CC(C3)CC(C5)C4)C6=NC=CC=N6 |
| InChI | InChI=1S/C28H37N5O/c34-26(28-17-22-13-23(18-28)15-24(14-22)19-28)31-25(16-21-5-2-1-3-6-21)20-32-9-11-33(12-10-32)27-29-7-4-8-30-27/h1-8,22-25H,9-20H2,(H,31,34)/t22?,23?,24?,25-,28?/m0/s1 |
| InChIKey | DSJKVFVLCHZWFJ-IPOSCIHWSA-N |
| XLogP | 4.40 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 652 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |