About 1H-Indole, 3,3'-methylenebis[5-methoxy-
1H-Indole, 3,3'-methylenebis[5-methoxy- (PubChem CID 9944370) has the molecular formula C19H18N2O2
and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-methoxy-3-[(5-methoxy-1H-indol-3-yl)methyl]-1H-indole.
Molecular Properties
| Compound Name | 1H-Indole, 3,3'-methylenebis[5-methoxy- |
| PubChem CID | 9944370 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-methoxy-3-[(5-methoxy-1H-indol-3-yl)methyl]-1H-indole |
| SMILES | COC1=CC2=C(C=C1)NC=C2CC3=CNC4=C3C=C(C=C4)OC |
| InChI | InChI=1S/C19H18N2O2/c1-22-14-3-5-18-16(8-14)12(10-20-18)7-13-11-21-19-6-4-15(23-2)9-17(13)19/h3-6,8-11,20-21H,7H2,1-2H3 |
| InChIKey | JTPGESPWPBXUEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 369 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-Indole, 3,3'-methylenebis[5-methoxy- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-Indole, 3,3'-methylenebis[5-methoxy-?
The IUPAC name of 1H-Indole, 3,3'-methylenebis[5-methoxy- (CID 9944370) is 5-methoxy-3-[(5-methoxy-1H-indol-3-yl)methyl]-1H-indole.
What is the SMILES notation for 1H-Indole, 3,3'-methylenebis[5-methoxy-?
The canonical SMILES for 1H-Indole, 3,3'-methylenebis[5-methoxy- is COC1=CC2=C(C=C1)NC=C2CC3=CNC4=C3C=C(C=C4)OC.
What is the InChIKey of 1H-Indole, 3,3'-methylenebis[5-methoxy-?
The InChIKey is JTPGESPWPBXUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-22-14-3-5-18-16(8-14)12(10-20-18)7-13-11-21-19-6-4-15(23-2)9-17(13)19/h3-6,8-11,20-21H,7H2,1-2H3.
What are the key properties of 1H-Indole, 3,3'-methylenebis[5-methoxy-?
1H-Indole, 3,3'-methylenebis[5-methoxy- has a molecular weight of 306.40 g/mol, XLogP of 4.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-Indole, 3,3'-methylenebis[5-methoxy- is sourced from PubChem (CID 9944370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).