C22H19N3O3S — CID 995334
ethyl 4-[[2-(3-cyano-7-methylquinolin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 995334) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is ethyl 4-[[2-(3-cyano-7-methylquinolin-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(3-cyano-7-methylquinolin-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 995334 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethyl 4-[[2-(3-cyano-7-methylquinolin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nc3cc(C)ccc3cc2C#N)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-3-28-22(27)15-6-8-18(9-7-15)24-20(26)13-29-21-17(12-23)11-16-5-4-14(2)10-19(16)25-21/h4-11H,3,13H2,1-2H3,(H,24,26) |
| InChIKey | OBQVIRKLMQNWQK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |