C32H48O3 — CID 99564953
[(1R,5S,6R)-6-bicyclo[3.2.1]oct-3-enyl] (4S)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 99564953) has the molecular formula C32H48O3 and a molecular weight of 480.73 g/mol. Its IUPAC name is [(1R,5S,6R)-6-bicyclo[3.2.1]oct-3-enyl] (4S)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | [(1R,5S,6R)-6-bicyclo[3.2.1]oct-3-enyl] (4S)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 99564953 |
| Molecular Formula | C32H48O3 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | [(1R,5S,6R)-6-bicyclo[3.2.1]oct-3-enyl] (4S)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@@H](CCC(=O)O[C@@H]1C[C@@H]2CC=C[C@@H]1C2)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H48O3/c1-20(7-12-30(34)35-29-18-21-5-4-6-22(29)17-21)26-10-11-27-25-9-8-23-19-24(33)13-15-31(23,2)28(25)14-16-32(26,27)3/h4,6,8,20-22,24-29,33H,5,7,9-19H2,1-3H3/t20-,21+,22+,24-,25-,26+,27-,28-,29+,31-,32+/m0/s1 |
| InChIKey | ARZPPTOMZUQGJG-RENAFADQSA-N |
| XLogP | 7.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|