C20H27Cl3O3 — CID 99566455
(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-(trichloromethyl)-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione (PubChem CID 99566455) has the molecular formula C20H27Cl3O3 and a molecular weight of 421.79 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-(trichloromethyl)-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-(trichloromethyl)-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 99566455 |
| Molecular Formula | C20H27Cl3O3 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-(trichloromethyl)-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione |
| SMILES | C[C@]12CC[C@](O)(C(Cl)(Cl)Cl)C[C@H]1CC(=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H27Cl3O3/c1-17-7-8-19(26,20(21,22)23)10-11(17)9-14(24)16-12-3-4-15(25)18(12,2)6-5-13(16)17/h11-13,16,26H,3-10H2,1-2H3/t11-,12+,13+,16+,17+,18+,19-/m1/s1 |
| InChIKey | PRKJWXBURFOVQU-YKVGSVILSA-N |
| XLogP | 4.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|