C28H40O6 — CID 99568254
[(3S,5R,8R,9S,10S,13S,14S,16R,17S)-17-acetyl-16-(2,4-dioxopentan-3-yl)-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99568254) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is [(3S,5R,8R,9S,10S,13S,14S,16R,17S)-17-acetyl-16-(2,4-dioxopentan-3-yl)-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,8R,9S,10S,13S,14S,16R,17S)-17-acetyl-16-(2,4-dioxopentan-3-yl)-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99568254 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [(3S,5R,8R,9S,10S,13S,14S,16R,17S)-17-acetyl-16-(2,4-dioxopentan-3-yl)-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC(=O)[C@@]2(C)[C@H]3C[C@@H](C(C(C)=O)C(C)=O)[C@@H]2C(C)=O)C1 |
| InChI | InChI=1S/C28H40O6/c1-14(29)25(15(2)30)21-12-23-20-8-7-18-11-19(34-17(4)32)9-10-27(18,5)22(20)13-24(33)28(23,6)26(21)16(3)31/h18-23,25-26H,7-13H2,1-6H3/t18-,19+,20-,21+,22+,23+,26+,27+,28-/m1/s1 |
| InChIKey | WWSXFPXFVRGNOL-SPTLBIIMSA-N |
| XLogP | 4.37 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|