C20H28N2O — CID 99568488
(1R,2S,4R,9S,12S,13R,16S)-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,7,18-trien-16-ol (PubChem CID 99568488) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (1R,2S,4R,9S,12S,13R,16S)-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,7,18-trien-16-ol.
| Compound Name | (1R,2S,4R,9S,12S,13R,16S)-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,7,18-trien-16-ol |
|---|---|
| PubChem CID | 99568488 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (1R,2S,4R,9S,12S,13R,16S)-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,7,18-trien-16-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C3=NN=C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C20H28N2O/c1-19-7-5-14(23)10-13(19)3-4-15-16(19)6-8-20(2)17(15)9-12-11-21-22-18(12)20/h3,11-12,14-17,23H,4-10H2,1-2H3/t12-,14+,15-,16+,17+,19+,20+/m1/s1 |
| InChIKey | ZOWUNTLIFRDPAL-OHLKBTDQSA-N |
| XLogP | 3.98 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|