C24H37ClN2O2 — CID 99568950
[(3R,5S,8R,9S,10S,13S,14S,17S)-17-[cyanomethyl(methyl)amino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate (PubChem CID 99568950) has the molecular formula C24H37ClN2O2 and a molecular weight of 421.03 g/mol. Its IUPAC name is [(3R,5S,8R,9S,10S,13S,14S,17S)-17-[cyanomethyl(methyl)amino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate.
| Compound Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-[cyanomethyl(methyl)amino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 99568950 |
| Molecular Formula | C24H37ClN2O2 |
| Molecular Weight | 421.03 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-[cyanomethyl(methyl)amino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate |
| SMILES | CN(CC#N)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)CCl)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H37ClN2O2/c1-23-10-8-17(29-22(28)15-25)14-16(23)4-5-18-19-6-7-21(27(3)13-12-26)24(19,2)11-9-20(18)23/h16-21H,4-11,13-15H2,1-3H3/t16-,17+,18-,19-,20-,21-,23-,24-/m0/s1 |
| InChIKey | JOKRPORJXQCDAP-GCAQEVDCSA-N |
| XLogP | 5.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|