C27H40N2O5 — CID 99568998
methyl (2S)-1-[2-[(E)-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]pyrrolidine-2-carboxylate (PubChem CID 99568998) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is methyl (2S)-1-[2-[(E)-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[(E)-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 99568998 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | methyl (2S)-1-[2-[(E)-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)CO/N=C1/C=C2CC[C@H]3[C@@H]4CC[C@@H](O)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC1 |
| InChI | InChI=1S/C27H40N2O5/c1-26-12-10-18(28-34-16-24(31)29-14-4-5-22(29)25(32)33-3)15-17(26)6-7-19-20-8-9-23(30)27(20,2)13-11-21(19)26/h15,19-23,30H,4-14,16H2,1-3H3/b28-18+/t19-,20-,21-,22-,23+,26-,27-/m0/s1 |
| InChIKey | ADIJLNHTNIIQSP-HLNKAWJSSA-N |
| XLogP | 3.85 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|