C29H35NO10 — CID 99569989
1-O-[2-[(8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) butanedioate (PubChem CID 99569989) has the molecular formula C29H35NO10 and a molecular weight of 557.60 g/mol. Its IUPAC name is 1-O-[2-[(8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) butanedioate.
| Compound Name | 1-O-[2-[(8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) butanedioate |
|---|---|
| PubChem CID | 99569989 |
| Molecular Formula | C29H35NO10 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 1-O-[2-[(8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) butanedioate |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@H](O)C[C@@]2(C)[C@H]1CC[C@@]2(O)C(=O)COC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C29H35NO10/c1-27-11-9-17(31)13-16(27)3-4-18-19-10-12-29(38,28(19,2)14-20(32)26(18)27)21(33)15-39-24(36)7-8-25(37)40-30-22(34)5-6-23(30)35/h9,11,13,18-20,26,32,38H,3-8,10,12,14-15H2,1-2H3/t18-,19-,20+,26+,27-,28-,29+/m0/s1 |
| InChIKey | SZMXBLNRSKSXJT-RGXGJHLCSA-N |
| XLogP | 1.50 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|