C24H36N2OS — CID 99570047
(2S)-2-[(5R,8R,9S,10S,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]-2-cyanoethanethioamide (PubChem CID 99570047) has the molecular formula C24H36N2OS and a molecular weight of 400.63 g/mol. Its IUPAC name is (2S)-2-[(5R,8R,9S,10S,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]-2-cyanoethanethioamide.
| Compound Name | (2S)-2-[(5R,8R,9S,10S,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]-2-cyanoethanethioamide |
|---|---|
| PubChem CID | 99570047 |
| Molecular Formula | C24H36N2OS |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (2S)-2-[(5R,8R,9S,10S,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]-2-cyanoethanethioamide |
| SMILES | CC(=O)[C@H]1[C@@H]([C@@H](C#N)C(N)=S)C[C@H]2[C@@H]3CC[C@H]4CCCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H36N2OS/c1-14(27)21-17(18(13-25)22(26)28)12-20-16-8-7-15-6-4-5-10-23(15,2)19(16)9-11-24(20,21)3/h15-21H,4-12H2,1-3H3,(H2,26,28)/t15-,16-,17-,18-,19+,20+,21+,23+,24+/m1/s1 |
| InChIKey | KKCSMFAZRNSRNN-GINUQZJTSA-N |
| XLogP | 5.28 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|