C26H38O5 — CID 99572030
methyl (E)-4-[(3S,5R,8R,9S,10S,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-oxobut-2-enoate (PubChem CID 99572030) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl (E)-4-[(3S,5R,8R,9S,10S,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[(3S,5R,8R,9S,10S,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 99572030 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | methyl (E)-4-[(3S,5R,8R,9S,10S,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H38O5/c1-16(27)31-18-11-13-25(2)17(15-18)5-6-19-20-7-8-22(23(28)9-10-24(29)30-4)26(20,3)14-12-21(19)25/h9-10,17-22H,5-8,11-15H2,1-4H3/b10-9+/t17-,18+,19+,20+,21+,22-,25+,26+/m1/s1 |
| InChIKey | AQYUDBVIVLGHDD-PELFAKFUSA-N |
| XLogP | 4.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|