C24H36O2 — CID 99572497
[(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 99572497) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 99572497 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | [(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-prop-2-enyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=CC[C@]1(OC(C)=O)CC[C@H]2[C@@H]3CC[C@@H]4CC=CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H36O2/c1-5-13-24(26-17(2)25)16-12-21-19-10-9-18-8-6-7-14-22(18,3)20(19)11-15-23(21,24)4/h5-7,18-21H,1,8-16H2,2-4H3/t18-,19+,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | ORIMLGKYXLWGDN-IWMXCVPLSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|