C28H33NOS — CID 99572514
(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenyl-1,3-thiazol-4-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 99572514) has the molecular formula C28H33NOS and a molecular weight of 431.65 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenyl-1,3-thiazol-4-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenyl-1,3-thiazol-4-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 99572514 |
| Molecular Formula | C28H33NOS |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenyl-1,3-thiazol-4-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@H]2c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H33NOS/c1-27-14-12-20(30)16-19(27)8-9-21-22-10-11-24(28(22,2)15-13-23(21)27)25-17-31-26(29-25)18-6-4-3-5-7-18/h3-7,16-17,21-24H,8-15H2,1-2H3/t21-,22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | JHWCRFGEAATSOO-YPZLOKHQSA-N |
| XLogP | 7.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |