C33H52N+ — CID 99574460
1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-methylpyridin-1-ium (PubChem CID 99574460) has the molecular formula C33H52N+ and a molecular weight of 462.79 g/mol. Its IUPAC name is 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-methylpyridin-1-ium.
| Compound Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-methylpyridin-1-ium |
|---|---|
| PubChem CID | 99574460 |
| Molecular Formula | C33H52N+ |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.41 |
| IUPAC Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-methylpyridin-1-ium |
| SMILES | Cc1cc[n+]([C@@H]2CC[C@@]3(C)C(=CC[C@H]4[C@@H]5CC[C@H]([C@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C33H52N/c1-23(2)8-7-9-25(4)29-12-13-30-28-11-10-26-22-27(34-20-16-24(3)17-21-34)14-18-32(26,5)31(28)15-19-33(29,30)6/h10,16-17,20-21,23,25,27-31H,7-9,11-15,18-19,22H2,1-6H3/q+1/t25-,27-,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | ZGJWGFCDWABXLV-WUQYGKSGSA-N |
| XLogP | 8.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|