C24H36O4S2 — CID 99574592
[(2S,5R,8R,9S,10S,13S,14S,17S)-2-ethoxycarbothioylsulfanyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 99574592) has the molecular formula C24H36O4S2 and a molecular weight of 452.68 g/mol. Its IUPAC name is [(2S,5R,8R,9S,10S,13S,14S,17S)-2-ethoxycarbothioylsulfanyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(2S,5R,8R,9S,10S,13S,14S,17S)-2-ethoxycarbothioylsulfanyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 99574592 |
| Molecular Formula | C24H36O4S2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [(2S,5R,8R,9S,10S,13S,14S,17S)-2-ethoxycarbothioylsulfanyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCOC(=S)S[C@H]1C[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]32)CC1=O |
| InChI | InChI=1S/C24H36O4S2/c1-5-27-22(29)30-20-13-24(4)15(12-19(20)26)6-7-16-17-8-9-21(28-14(2)25)23(17,3)11-10-18(16)24/h15-18,20-21H,5-13H2,1-4H3/t15-,16+,17+,18+,20+,21+,23+,24+/m1/s1 |
| InChIKey | GAIUIGKBBLJCQM-BKGRRPOGSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|