C27H38O2 — CID 99576145
(1S,2S,7R,10R,11S,14S,15S,23R,24R)-7-hydroxy-10,14-dimethylhexacyclo[12.11.0.02,11.05,10.015,24.018,23]pentacosa-4,17-dien-16-one (PubChem CID 99576145) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is (1S,2S,7R,10R,11S,14S,15S,23R,24R)-7-hydroxy-10,14-dimethylhexacyclo[12.11.0.02,11.05,10.015,24.018,23]pentacosa-4,17-dien-16-one.
| Compound Name | (1S,2S,7R,10R,11S,14S,15S,23R,24R)-7-hydroxy-10,14-dimethylhexacyclo[12.11.0.02,11.05,10.015,24.018,23]pentacosa-4,17-dien-16-one |
|---|---|
| PubChem CID | 99576145 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (1S,2S,7R,10R,11S,14S,15S,23R,24R)-7-hydroxy-10,14-dimethylhexacyclo[12.11.0.02,11.05,10.015,24.018,23]pentacosa-4,17-dien-16-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@H](O)CC[C@@]43C)[C@@H]1C[C@@H]1[C@H]3CCCCC3=CC(=O)[C@@H]12 |
| InChI | InChI=1S/C27H38O2/c1-26-11-9-18(28)14-17(26)7-8-20-22(26)10-12-27(2)23(20)15-21-19-6-4-3-5-16(19)13-24(29)25(21)27/h7,13,18-23,25,28H,3-6,8-12,14-15H2,1-2H3/t18-,19+,20-,21-,22+,23+,25-,26+,27+/m1/s1 |
| InChIKey | RWSNWUWVSNWYPS-SHOVYKMPSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|